|
Synthesis and antibacterial evaluation of Fe3O4/ZrO2/CuMoO4 magnetic nanoparticles against Gram-positive and Gram-negative bacteria
|
|
|
Journal of the Iranian Chemical Society JICS
|
|
Design of Fe3O4/MoO3/CuO nanocomposite for decontamination of organic dyes from water
|
10.1007/s13738-025-03189-w |
|
Journal of the Iranian Chemical Society JICS
|
|
Fabrication of Fe3O4/Al2O3/CuO magnetic nanocomposite and effective in the photedegradation of methylene blue
|
10.1007/s13738-024-03027-5 |
|
Journal of the Iranian Chemical Society JICS
|
|
Synthesis of Fe3O4/ZrO2/ZnO nanoparticle for enhancing visible light photocatalytic and antibacterial activity
|
10.1016/j.jtice.2023.105213 |
|
|
|
Synthesis of Fe<sub>3</sub>O<sub>4</sub>/ZrO<sub>2</sub>/CuO magnetic nanohybrids and their applications in reducing chromium(<scp>vi</scp>) and degrading methylene blue under sunlight
|
10.1039/D3NJ02101G |
|
|
|
Photocatalytic activity of the novel triazine-based magnetic core-shell Cu nanocomposite for degradation of RhB and MB via air oxidation and Cr(VI) reduction
|
10.1016/j.enmm.2023.100820 |
|
|
|
Synthesis and characterization of magnetically recoverable CoFe2O4/ZnS/CuO nanoparticles as an effective photocatalyst and catalyst for degradation of MB and reduction of 4-nitrophenol
|
10.1007/s00339-022-05875-5 |
|
|
|
Synthesizing and characterization of Cu(II) polymer complex: application for removing heavy metals from aqueous solutions
|
10.1007/s13738-021-02437-z |
|
|
|
Fabrication of heterojunction ternary Fe3O4\/TiO2\/CoMoO4 as a magnetic photocatalyst for organic dyes degradation under sunlight irradiation
|
10.1016/j.jphotochem.2021.113596 |
|
|
|
Photocatalytic degradation and mineralization of dye pollutants from wastewater under visible light using synthetic CuO-VO2/TiO2 nanotubes/nanosheets
|
10.1007/s10854-021-06486-1 |
|
|
|
Synthesis and characterization of the magnetic submicrocube Fe 3 O 4 /TiO 2 /CuO as a reusable photocatalyst for the degradation of dyes under sunlight irradiation
|
10.1016/j.eti.2021.101756 |
|
|
|
Degradation of MB and RhB by modified ZrO 2 nanoparticles via sunlight
|
# |
|
|
|
كاهش پارا -نيترو فنول واورتو نيتروفنول با استفاده ازمس( II)تثبيت شده برروي سيليكا ي مزو حفره KIT-5
|
# |
|
|
|
Hydrothermal synthesis and characterization of CuO-CoO/TiO2 for photocatalytic degradation of methylene blue under visible light and catalytic reduction of P-nitrophenol
|
10.1007/s10854-020-04044-9 |
|
|
|
سنتز، شناسايي و بررسي ويژگي مغناطيسي نانوكامپوزيتCo3O4/CoFe2O4با استفاده از كلسينهكردن نمك كمپلكسهاي دوتاييCo(Salen)(PPh3)(H2o)4fe(CN)6وCo(Salophen)(PPh3)(H2o)4fe(CN)6
|
# |
|
|
|
Synthesis and characterization of a novel Schiff base polyamide ligand and its copper(II) complex for comparative removal of Pb(II) ions from aqueous solutions
|
# |
|
|
|
Catalytic reduction of 4-nitrophenol by means of nanostructured polymeric Schiff base complexes
|
# |
|
|
|
Synthesis, characterization and investigation of photocatalytic and catalytic applications of Fe3O4/TiO2/CuO nanoparticles for degradation of MB and reduction of nitrophenols
|
# |
|
|
|
مطالعه واجذب - يونش كمپلكسهاي Co(H2O)6(NO3)2 ، Co(H2O)7SO4، (Co(NH3)5Cl)Cl2،(Co(NH3)4CO3)NO3،(Fe(H2O)6CO3)SO4،(Fe(H2O)7)(NO3)3 با استفاده از روش طيف سنجي جرمي زمان پرواز با منبع تابش ليزر
|
# |
|
|
|
Interaction of Novel Ni2+, Cu2+ and VO2+ Complexes of a Tridentate Schiff Base Ligand with DNA, BSA and their Cytotoxic Activity
|
# |
|
|